About 2-chloroethenylbenzene;2,6-dimethylpiperidine
2-chloroethenylbenzene;2,6-dimethylpiperidine (PubChem CID 174658735) has the molecular formula C15H22ClN
and a molecular weight of 251.80 g/mol. Its IUPAC name is 2-chloroethenylbenzene;2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | 2-chloroethenylbenzene;2,6-dimethylpiperidine |
| PubChem CID | 174658735 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-chloroethenylbenzene;2,6-dimethylpiperidine |
| SMILES | CC1CCCC(C)N1.ClC=Cc1ccccc1 |
| InChI | InChI=1S/C8H7Cl.C7H15N/c9-7-6-8-4-2-1-3-5-8;1-6-4-3-5-7(2)8-6/h1-7H;6-8H,3-5H2,1-2H3 |
| InChIKey | CMAAYVKEQKOCDJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloroethenylbenzene;2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethenylbenzene;2,6-dimethylpiperidine?
The IUPAC name of 2-chloroethenylbenzene;2,6-dimethylpiperidine (CID 174658735) is 2-chloroethenylbenzene;2,6-dimethylpiperidine.
What is the SMILES notation for 2-chloroethenylbenzene;2,6-dimethylpiperidine?
The canonical SMILES for 2-chloroethenylbenzene;2,6-dimethylpiperidine is CC1CCCC(C)N1.ClC=Cc1ccccc1.
What is the InChIKey of 2-chloroethenylbenzene;2,6-dimethylpiperidine?
The InChIKey is CMAAYVKEQKOCDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl.C7H15N/c9-7-6-8-4-2-1-3-5-8;1-6-4-3-5-7(2)8-6/h1-7H;6-8H,3-5H2,1-2H3.
What are the key properties of 2-chloroethenylbenzene;2,6-dimethylpiperidine?
2-chloroethenylbenzene;2,6-dimethylpiperidine has a molecular weight of 251.80 g/mol, XLogP of 4.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethenylbenzene;2,6-dimethylpiperidine is sourced from PubChem (CID 174658735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).