About 2-aminobenzaldehyde;2,6-dimethylpiperidine
2-aminobenzaldehyde;2,6-dimethylpiperidine (PubChem CID 174386863) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-aminobenzaldehyde;2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | 2-aminobenzaldehyde;2,6-dimethylpiperidine |
| PubChem CID | 174386863 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-aminobenzaldehyde;2,6-dimethylpiperidine |
| SMILES | CC1CCCC(C)N1.Nc1ccccc1C=O |
| InChI | InChI=1S/C7H7NO.C7H15N/c8-7-4-2-1-3-6(7)5-9;1-6-4-3-5-7(2)8-6/h1-5H,8H2;6-8H,3-5H2,1-2H3 |
| InChIKey | UDCZDPOCTMWVNJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzaldehyde;2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzaldehyde;2,6-dimethylpiperidine?
The IUPAC name of 2-aminobenzaldehyde;2,6-dimethylpiperidine (CID 174386863) is 2-aminobenzaldehyde;2,6-dimethylpiperidine.
What is the SMILES notation for 2-aminobenzaldehyde;2,6-dimethylpiperidine?
The canonical SMILES for 2-aminobenzaldehyde;2,6-dimethylpiperidine is CC1CCCC(C)N1.Nc1ccccc1C=O.
What is the InChIKey of 2-aminobenzaldehyde;2,6-dimethylpiperidine?
The InChIKey is UDCZDPOCTMWVNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C7H15N/c8-7-4-2-1-3-6(7)5-9;1-6-4-3-5-7(2)8-6/h1-5H,8H2;6-8H,3-5H2,1-2H3.
What are the key properties of 2-aminobenzaldehyde;2,6-dimethylpiperidine?
2-aminobenzaldehyde;2,6-dimethylpiperidine has a molecular weight of 234.34 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzaldehyde;2,6-dimethylpiperidine is sourced from PubChem (CID 174386863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).