C14H22N2O — CID 174386863
2-aminobenzaldehyde;2,6-dimethylpiperidine (PubChem CID 174386863) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-aminobenzaldehyde;2,6-dimethylpiperidine.
| Compound Name | 2-aminobenzaldehyde;2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 174386863 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-aminobenzaldehyde;2,6-dimethylpiperidine |
| SMILES | CC1CCCC(C)N1.Nc1ccccc1C=O |
| InChI | InChI=1S/C7H7NO.C7H15N/c8-7-4-2-1-3-6(7)5-9;1-6-4-3-5-7(2)8-6/h1-5H,8H2;6-8H,3-5H2,1-2H3 |
| InChIKey | UDCZDPOCTMWVNJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|