About 2-aminobenzaldehyde;2-bromobenzenesulfonic acid
2-aminobenzaldehyde;2-bromobenzenesulfonic acid (PubChem CID 175498765) has the molecular formula C13H12BrNO4S
and a molecular weight of 358.21 g/mol. Its IUPAC name is 2-aminobenzaldehyde;2-bromobenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-aminobenzaldehyde;2-bromobenzenesulfonic acid |
| PubChem CID | 175498765 |
| Molecular Formula | C13H12BrNO4S |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2-aminobenzaldehyde;2-bromobenzenesulfonic acid |
| SMILES | Nc1ccccc1C=O.O=S(=O)(O)c1ccccc1Br |
| InChI | InChI=1S/C7H7NO.C6H5BrO3S/c8-7-4-2-1-3-6(7)5-9;7-5-3-1-2-4-6(5)11(8,9)10/h1-5H,8H2;1-4H,(H,8,9,10) |
| InChIKey | VRHVZNLSQRXQAX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzaldehyde;2-bromobenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzaldehyde;2-bromobenzenesulfonic acid?
The IUPAC name of 2-aminobenzaldehyde;2-bromobenzenesulfonic acid (CID 175498765) is 2-aminobenzaldehyde;2-bromobenzenesulfonic acid.
What is the SMILES notation for 2-aminobenzaldehyde;2-bromobenzenesulfonic acid?
The canonical SMILES for 2-aminobenzaldehyde;2-bromobenzenesulfonic acid is Nc1ccccc1C=O.O=S(=O)(O)c1ccccc1Br.
What is the InChIKey of 2-aminobenzaldehyde;2-bromobenzenesulfonic acid?
The InChIKey is VRHVZNLSQRXQAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C6H5BrO3S/c8-7-4-2-1-3-6(7)5-9;7-5-3-1-2-4-6(5)11(8,9)10/h1-5H,8H2;1-4H,(H,8,9,10).
What are the key properties of 2-aminobenzaldehyde;2-bromobenzenesulfonic acid?
2-aminobenzaldehyde;2-bromobenzenesulfonic acid has a molecular weight of 358.21 g/mol, XLogP of 2.78, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzaldehyde;2-bromobenzenesulfonic acid is sourced from PubChem (CID 175498765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).