C32H40P2Pt — CID 10886947
(2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;platinum;(E)-stilbene (PubChem CID 10886947) has the molecular formula C32H40P2Pt and a molecular weight of 681.70 g/mol. Its IUPAC name is (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;platinum;(E)-stilbene.
| Compound Name | (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;platinum;(E)-stilbene |
|---|---|
| PubChem CID | 10886947 |
| Molecular Formula | C32H40P2Pt |
| Molecular Weight | 681.70 g/mol |
| Exact Mass | 681.23 |
| IUPAC Name | (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;platinum;(E)-stilbene |
| SMILES | C(=C/c1ccccc1)\c1ccccc1.C[C@@H]1CC[C@@H](C)P1c1ccccc1P1[C@H](C)CC[C@H]1C.[Pt] |
| InChI | InChI=1S/C18H28P2.C14H12.Pt/c1-13-9-10-14(2)19(13)17-7-5-6-8-18(17)20-15(3)11-12-16(20)4;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;/h5-8,13-16H,9-12H2,1-4H3;1-12H;/b;12-11+;/t13-,14-,15-,16-;;/m1../s1 |
| InChIKey | JKNAMLSVQRUAAA-GDBHMGLQSA-N |
| XLogP | 8.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.70 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|