C16H24IP — CID 10452015
(1S,6R)-9-ethyl-9-phenyl-9-phosphoniabicyclo[4.2.1]nonane iodide (PubChem CID 10452015) has the molecular formula C16H24IP and a molecular weight of 374.25 g/mol. Its IUPAC name is (1S,6R)-9-ethyl-9-phenyl-9-phosphoniabicyclo[4.2.1]nonane iodide.
| Compound Name | (1S,6R)-9-ethyl-9-phenyl-9-phosphoniabicyclo[4.2.1]nonane iodide |
|---|---|
| PubChem CID | 10452015 |
| Molecular Formula | C16H24IP |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (1S,6R)-9-ethyl-9-phenyl-9-phosphoniabicyclo[4.2.1]nonane iodide |
| SMILES | CC[P+]1(c2ccccc2)[C@@H]2CCCC[C@H]1CC2.[I-] |
| InChI | InChI=1S/C16H24P.HI/c1-2-17(14-8-4-3-5-9-14)15-10-6-7-11-16(17)13-12-15;/h3-5,8-9,15-16H,2,6-7,10-13H2,1H3;1H/q+1;/p-1/t15-,16+,17?; |
| InChIKey | HSMYFPCTMMCBIS-NDRUTXPUSA-M |
| XLogP | 1.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|