About cyclopentyl(triphenyl)phosphanium;phosphane;iodide
cyclopentyl(triphenyl)phosphanium;phosphane;iodide (PubChem CID 174786242) has the molecular formula C23H27IP2
and a molecular weight of 492.32 g/mol. Its IUPAC name is cyclopentyl(triphenyl)phosphanium;phosphane;iodide.
Molecular Properties
| Compound Name | cyclopentyl(triphenyl)phosphanium;phosphane;iodide |
| PubChem CID | 174786242 |
| Molecular Formula | C23H27IP2 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | cyclopentyl(triphenyl)phosphanium;phosphane;iodide |
| SMILES | P.[I-].c1ccc([P+](c2ccccc2)(c2ccccc2)C2CCCC2)cc1 |
| InChI | InChI=1S/C23H24P.HI.H3P/c1-4-12-20(13-5-1)24(23-18-10-11-19-23,21-14-6-2-7-15-21)22-16-8-3-9-17-22;;/h1-9,12-17,23H,10-11,18-19H2;1H;1H3/q+1;;/p-1 |
| InChIKey | JSBHDELMIGVRII-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl(triphenyl)phosphanium;phosphane;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl(triphenyl)phosphanium;phosphane;iodide?
The IUPAC name of cyclopentyl(triphenyl)phosphanium;phosphane;iodide (CID 174786242) is cyclopentyl(triphenyl)phosphanium;phosphane;iodide.
What is the SMILES notation for cyclopentyl(triphenyl)phosphanium;phosphane;iodide?
The canonical SMILES for cyclopentyl(triphenyl)phosphanium;phosphane;iodide is P.[I-].c1ccc([P+](c2ccccc2)(c2ccccc2)C2CCCC2)cc1.
What is the InChIKey of cyclopentyl(triphenyl)phosphanium;phosphane;iodide?
The InChIKey is JSBHDELMIGVRII-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H24P.HI.H3P/c1-4-12-20(13-5-1)24(23-18-10-11-19-23,21-14-6-2-7-15-21)22-16-8-3-9-17-22;;/h1-9,12-17,23H,10-11,18-19H2;1H;1H3/q+1;;/p-1.
What are the key properties of cyclopentyl(triphenyl)phosphanium;phosphane;iodide?
cyclopentyl(triphenyl)phosphanium;phosphane;iodide has a molecular weight of 492.32 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl(triphenyl)phosphanium;phosphane;iodide is sourced from PubChem (CID 174786242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).