C20H24F2P+ — CID 132552925
cyclohexyl-(2,2-difluoroethyl)-diphenylphosphanium (PubChem CID 132552925) has the molecular formula C20H24F2P+ and a molecular weight of 333.38 g/mol. Its IUPAC name is cyclohexyl-(2,2-difluoroethyl)-diphenylphosphanium.
| Compound Name | cyclohexyl-(2,2-difluoroethyl)-diphenylphosphanium |
|---|---|
| PubChem CID | 132552925 |
| Molecular Formula | C20H24F2P+ |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | cyclohexyl-(2,2-difluoroethyl)-diphenylphosphanium |
| SMILES | FC(F)C[P+](c1ccccc1)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H24F2P/c21-20(22)16-23(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-2,4-7,10-13,19-20H,3,8-9,14-16H2/q+1 |
| InChIKey | QSFLIHQCARSXHC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|