C51H54OP2+2 — CID 57342175
cyclohexyl-[[4-[4-[[cyclohexyl(diphenyl)phosphaniumyl]methyl]benzoyl]phenyl]methyl]-diphenylphosphanium (PubChem CID 57342175) has the molecular formula C51H54OP2+2 and a molecular weight of 744.94 g/mol. Its IUPAC name is cyclohexyl-[[4-[4-[[cyclohexyl(diphenyl)phosphaniumyl]methyl]benzoyl]phenyl]methyl]-diphenylphosphanium.
| Compound Name | cyclohexyl-[[4-[4-[[cyclohexyl(diphenyl)phosphaniumyl]methyl]benzoyl]phenyl]methyl]-diphenylphosphanium |
|---|---|
| PubChem CID | 57342175 |
| Molecular Formula | C51H54OP2+2 |
| Molecular Weight | 744.94 g/mol |
| Exact Mass | 744.36 |
| IUPAC Name | cyclohexyl-[[4-[4-[[cyclohexyl(diphenyl)phosphaniumyl]methyl]benzoyl]phenyl]methyl]-diphenylphosphanium |
| SMILES | O=C(c1ccc(C[P+](c2ccccc2)(c2ccccc2)C2CCCCC2)cc1)c1ccc(C[P+](c2ccccc2)(c2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C51H54OP2/c52-51(43-35-31-41(32-36-43)39-53(45-19-7-1-8-20-45,46-21-9-2-10-22-46)47-23-11-3-12-24-47)44-37-33-42(34-38-44)40-54(48-25-13-4-14-26-48,49-27-15-5-16-28-49)50-29-17-6-18-30-50/h1-2,4-5,7-10,13-16,19-22,25-28,31-38,47,50H,3,6,11-12,17-18,23-24,29-30,39-40H2/q+2 |
| InChIKey | CPLDZHGBQOHWLO-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.94 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|