About cyclopentyl(triphenyl)phosphanium;heptanoate
cyclopentyl(triphenyl)phosphanium;heptanoate (PubChem CID 19082498) has the molecular formula C30H37O2P
and a molecular weight of 460.60 g/mol. Its IUPAC name is cyclopentyl(triphenyl)phosphanium;heptanoate.
Molecular Properties
| Compound Name | cyclopentyl(triphenyl)phosphanium;heptanoate |
| PubChem CID | 19082498 |
| Molecular Formula | C30H37O2P |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | cyclopentyl(triphenyl)phosphanium;heptanoate |
| SMILES | CCCCCCC(=O)[O-].c1ccc([P+](c2ccccc2)(c2ccccc2)C2CCCC2)cc1 |
| InChI | InChI=1S/C23H24P.C7H14O2/c1-4-12-20(13-5-1)24(23-18-10-11-19-23,21-14-6-2-7-15-21)22-16-8-3-9-17-22;1-2-3-4-5-6-7(8)9/h1-9,12-17,23H,10-11,18-19H2;2-6H2,1H3,(H,8,9)/q+1;/p-1 |
| InChIKey | DPDBXEBGVSEAKR-UHFFFAOYSA-M |
| XLogP | 5.63 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl(triphenyl)phosphanium;heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl(triphenyl)phosphanium;heptanoate?
The IUPAC name of cyclopentyl(triphenyl)phosphanium;heptanoate (CID 19082498) is cyclopentyl(triphenyl)phosphanium;heptanoate.
What is the SMILES notation for cyclopentyl(triphenyl)phosphanium;heptanoate?
The canonical SMILES for cyclopentyl(triphenyl)phosphanium;heptanoate is CCCCCCC(=O)[O-].c1ccc([P+](c2ccccc2)(c2ccccc2)C2CCCC2)cc1.
What is the InChIKey of cyclopentyl(triphenyl)phosphanium;heptanoate?
The InChIKey is DPDBXEBGVSEAKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H24P.C7H14O2/c1-4-12-20(13-5-1)24(23-18-10-11-19-23,21-14-6-2-7-15-21)22-16-8-3-9-17-22;1-2-3-4-5-6-7(8)9/h1-9,12-17,23H,10-11,18-19H2;2-6H2,1H3,(H,8,9)/q+1;/p-1.
What are the key properties of cyclopentyl(triphenyl)phosphanium;heptanoate?
cyclopentyl(triphenyl)phosphanium;heptanoate has a molecular weight of 460.60 g/mol, XLogP of 5.63, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl(triphenyl)phosphanium;heptanoate is sourced from PubChem (CID 19082498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).