About cerium(3+);octanoate
cerium(3+);octanoate (PubChem CID 21123895) has the molecular formula C8H15CeO2+2
and a molecular weight of 283.32 g/mol. Its IUPAC name is cerium(3+);octanoate.
Molecular Properties
| Compound Name | cerium(3+);octanoate |
| PubChem CID | 21123895 |
| Molecular Formula | C8H15CeO2+2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | cerium(3+);octanoate |
| SMILES | CCCCCCCC(=O)[O-].[Ce+3] |
| InChI | InChI=1S/C8H16O2.Ce/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+3/p-1 |
| InChIKey | BXFLOJVJKAGWAA-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cerium(3+);octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium(3+);octanoate?
The IUPAC name of cerium(3+);octanoate (CID 21123895) is cerium(3+);octanoate.
What is the SMILES notation for cerium(3+);octanoate?
The canonical SMILES for cerium(3+);octanoate is CCCCCCCC(=O)[O-].[Ce+3].
What is the InChIKey of cerium(3+);octanoate?
The InChIKey is BXFLOJVJKAGWAA-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.Ce/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+3/p-1.
What are the key properties of cerium(3+);octanoate?
cerium(3+);octanoate has a molecular weight of 283.32 g/mol, XLogP of 1.10, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cerium(3+);octanoate is sourced from PubChem (CID 21123895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).