About chloromethylcyclohexane;triphenylphosphane
chloromethylcyclohexane;triphenylphosphane (PubChem CID 87799022) has the molecular formula C25H28ClP
and a molecular weight of 394.93 g/mol. Its IUPAC name is chloromethylcyclohexane;triphenylphosphane.
Molecular Properties
| Compound Name | chloromethylcyclohexane;triphenylphosphane |
| PubChem CID | 87799022 |
| Molecular Formula | C25H28ClP |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | chloromethylcyclohexane;triphenylphosphane |
| SMILES | ClCC1CCCCC1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C7H13Cl/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-6-7-4-2-1-3-5-7/h1-15H;7H,1-6H2 |
| InChIKey | MQYRUJRXBDDIKT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloromethylcyclohexane;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethylcyclohexane;triphenylphosphane?
The IUPAC name of chloromethylcyclohexane;triphenylphosphane (CID 87799022) is chloromethylcyclohexane;triphenylphosphane.
What is the SMILES notation for chloromethylcyclohexane;triphenylphosphane?
The canonical SMILES for chloromethylcyclohexane;triphenylphosphane is ClCC1CCCCC1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of chloromethylcyclohexane;triphenylphosphane?
The InChIKey is MQYRUJRXBDDIKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C7H13Cl/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-6-7-4-2-1-3-5-7/h1-15H;7H,1-6H2.
What are the key properties of chloromethylcyclohexane;triphenylphosphane?
chloromethylcyclohexane;triphenylphosphane has a molecular weight of 394.93 g/mol, XLogP of 6.25, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethylcyclohexane;triphenylphosphane is sourced from PubChem (CID 87799022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).