About cyclooctene;triphenylphosphane
cyclooctene;triphenylphosphane (PubChem CID 175429598) has the molecular formula C26H29P
and a molecular weight of 372.49 g/mol. Its IUPAC name is cyclooctene;triphenylphosphane.
Molecular Properties
| Compound Name | cyclooctene;triphenylphosphane |
| PubChem CID | 175429598 |
| Molecular Formula | C26H29P |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | cyclooctene;triphenylphosphane |
| SMILES | C1=CCCCCCC1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C8H14/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-8-7-5-3-1/h1-15H;1-2H,3-8H2 |
| InChIKey | WRVMGHLJWSEFLJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclooctene;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctene;triphenylphosphane?
The IUPAC name of cyclooctene;triphenylphosphane (CID 175429598) is cyclooctene;triphenylphosphane.
What is the SMILES notation for cyclooctene;triphenylphosphane?
The canonical SMILES for cyclooctene;triphenylphosphane is C1=CCCCCCC1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of cyclooctene;triphenylphosphane?
The InChIKey is WRVMGHLJWSEFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C8H14/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-8-7-5-3-1/h1-15H;1-2H,3-8H2.
What are the key properties of cyclooctene;triphenylphosphane?
cyclooctene;triphenylphosphane has a molecular weight of 372.49 g/mol, XLogP of 6.34, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctene;triphenylphosphane is sourced from PubChem (CID 175429598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).