C15H14O2P+ — CID 158899856
3,3-diphenyl-1,3-oxaphospholan-3-ium-5-one (PubChem CID 158899856) has the molecular formula C15H14O2P+ and a molecular weight of 257.25 g/mol. Its IUPAC name is 3,3-diphenyl-1,3-oxaphospholan-3-ium-5-one.
| Compound Name | 3,3-diphenyl-1,3-oxaphospholan-3-ium-5-one |
|---|---|
| PubChem CID | 158899856 |
| Molecular Formula | C15H14O2P+ |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3,3-diphenyl-1,3-oxaphospholan-3-ium-5-one |
| SMILES | O=C1C[P+](c2ccccc2)(c2ccccc2)CO1 |
| InChI | InChI=1S/C15H14O2P/c16-15-11-18(12-17-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12H2/q+1 |
| InChIKey | NPRTUGQWMOKFKE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|