C10H9NO4P+ — CID 10900713
8-phenyl-3,5-dihydro-[1,3,2]oxazaphospholo[2,3-b][1,3,2]oxazaphosphol-8-ium-2,6-dione (PubChem CID 10900713) has the molecular formula C10H9NO4P+ and a molecular weight of 238.16 g/mol. Its IUPAC name is 8-phenyl-3,5-dihydro-[1,3,2]oxazaphospholo[2,3-b][1,3,2]oxazaphosphol-8-ium-2,6-dione.
| Compound Name | 8-phenyl-3,5-dihydro-[1,3,2]oxazaphospholo[2,3-b][1,3,2]oxazaphosphol-8-ium-2,6-dione |
|---|---|
| PubChem CID | 10900713 |
| Molecular Formula | C10H9NO4P+ |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 8-phenyl-3,5-dihydro-[1,3,2]oxazaphospholo[2,3-b][1,3,2]oxazaphosphol-8-ium-2,6-dione |
| SMILES | O=C1CN2CC(=O)O[P+]2(c2ccccc2)O1 |
| InChI | InChI=1S/C10H9NO4P/c12-9-6-11-7-10(13)15-16(11,14-9)8-4-2-1-3-5-8/h1-5H,6-7H2/q+1 |
| InChIKey | VENYAYOXNSLZKE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|