C18H14O2P+ — CID 101355568
2,2-diphenyl-1,3,2-benzodioxaphosphol-2-ium (PubChem CID 101355568) has the molecular formula C18H14O2P+ and a molecular weight of 293.28 g/mol. Its IUPAC name is 2,2-diphenyl-1,3,2-benzodioxaphosphol-2-ium.
| Compound Name | 2,2-diphenyl-1,3,2-benzodioxaphosphol-2-ium |
|---|---|
| PubChem CID | 101355568 |
| Molecular Formula | C18H14O2P+ |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2,2-diphenyl-1,3,2-benzodioxaphosphol-2-ium |
| SMILES | c1ccc([P+]2(c3ccccc3)Oc3ccccc3O2)cc1 |
| InChI | InChI=1S/C18H14O2P/c1-3-9-15(10-4-1)21(16-11-5-2-6-12-16)19-17-13-7-8-14-18(17)20-21/h1-14H/q+1 |
| InChIKey | BZHBAESYIWIXAI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|