C18H12O2P+ — CID 102464447
spiro[1,3,2-benzodioxaphosphol-2-ium-2,5'-benzo[b]phosphindol-5-ium] (PubChem CID 102464447) has the molecular formula C18H12O2P+ and a molecular weight of 291.27 g/mol. Its IUPAC name is spiro[1,3,2-benzodioxaphosphol-2-ium-2,5'-benzo[b]phosphindol-5-ium].
| Compound Name | spiro[1,3,2-benzodioxaphosphol-2-ium-2,5'-benzo[b]phosphindol-5-ium] |
|---|---|
| PubChem CID | 102464447 |
| Molecular Formula | C18H12O2P+ |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | spiro[1,3,2-benzodioxaphosphol-2-ium-2,5'-benzo[b]phosphindol-5-ium] |
| SMILES | c1ccc2c(c1)O[P+]1(O2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H12O2P/c1-5-11-17-13(7-1)14-8-2-6-12-18(14)21(17)19-15-9-3-4-10-16(15)20-21/h1-12H/q+1 |
| InChIKey | RPJLGVWFZQYLPG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|