C20H26P+ — CID 139085011
5,5-ditert-butylbenzo[b]phosphindol-5-ium (PubChem CID 139085011) has the molecular formula C20H26P+ and a molecular weight of 297.40 g/mol. Its IUPAC name is 5,5-ditert-butylbenzo[b]phosphindol-5-ium.
| Compound Name | 5,5-ditert-butylbenzo[b]phosphindol-5-ium |
|---|---|
| PubChem CID | 139085011 |
| Molecular Formula | C20H26P+ |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 5,5-ditert-butylbenzo[b]phosphindol-5-ium |
| SMILES | CC(C)(C)[P+]1(C(C)(C)C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H26P/c1-19(2,3)21(20(4,5)6)17-13-9-7-11-15(17)16-12-8-10-14-18(16)21/h7-14H,1-6H3/q+1 |
| InChIKey | HUABDKZDHRTISZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|