C22H28O2Si — CID 6427380
(3aS,11bR)-2,2-ditert-butyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxasilole (PubChem CID 6427380) has the molecular formula C22H28O2Si and a molecular weight of 352.55 g/mol. Its IUPAC name is (3aS,11bR)-2,2-ditert-butyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxasilole.
| Compound Name | (3aS,11bR)-2,2-ditert-butyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxasilole |
|---|---|
| PubChem CID | 6427380 |
| Molecular Formula | C22H28O2Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (3aS,11bR)-2,2-ditert-butyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxasilole |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)O[C@@H]2c3ccccc3-c3ccccc3[C@@H]2O1 |
| InChI | InChI=1S/C22H28O2Si/c1-21(2,3)25(22(4,5)6)23-19-17-13-9-7-11-15(17)16-12-8-10-14-18(16)20(19)24-25/h7-14,19-20H,1-6H3/t19-,20+ |
| InChIKey | WEEBMLUMSOLDIX-BGYRXZFFSA-N |
| XLogP | 6.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|