About CID 11112856
CID 11112856 (PubChem CID 11112856) has the molecular formula C21H19
and a molecular weight of 271.38 g/mol.
Molecular Properties
| Compound Name | CID 11112856 |
| PubChem CID | 11112856 |
| Molecular Formula | C21H19 |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | — |
| SMILES | CC(C)([C]1[CH][CH][CH][CH]1)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H19/c1-21(2,15-9-3-4-10-15)20-18-13-7-5-11-16(18)17-12-6-8-14-19(17)20/h3-14,20H,1-2H3 |
| InChIKey | ZHRSRWAYEMOQQY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 11112856 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11112856?
The IUPAC name of CID 11112856 (CID 11112856) is not available.
What is the SMILES notation for CID 11112856?
The canonical SMILES for CID 11112856 is CC(C)([C]1[CH][CH][CH][CH]1)C1c2ccccc2-c2ccccc21.
What is the InChIKey of CID 11112856?
The InChIKey is ZHRSRWAYEMOQQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19/c1-21(2,15-9-3-4-10-15)20-18-13-7-5-11-16(18)17-12-6-8-14-19(17)20/h3-14,20H,1-2H3.
What are the key properties of CID 11112856?
CID 11112856 has a molecular weight of 271.38 g/mol, XLogP of 5.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11112856 is sourced from PubChem (CID 11112856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).