C18H14NO3P — CID 122401637
6-oxido-N-phenylbenzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-amine (PubChem CID 122401637) has the molecular formula C18H14NO3P and a molecular weight of 323.29 g/mol. Its IUPAC name is 6-oxido-N-phenylbenzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-amine.
| Compound Name | 6-oxido-N-phenylbenzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-amine |
|---|---|
| PubChem CID | 122401637 |
| Molecular Formula | C18H14NO3P |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 6-oxido-N-phenylbenzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-amine |
| SMILES | [O-][P+]1(Nc2ccccc2)Oc2ccccc2-c2ccccc2O1 |
| InChI | InChI=1S/C18H14NO3P/c20-23(19-14-8-2-1-3-9-14)21-17-12-6-4-10-15(17)16-11-5-7-13-18(16)22-23/h1-13H,(H,19,20) |
| InChIKey | NMWZNQJWOYTXSS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|