About (5R)-5-phenyl-4,5-dihydro-1,3-oxazole
(5R)-5-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 91555528) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is (5R)-5-phenyl-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | (5R)-5-phenyl-4,5-dihydro-1,3-oxazole |
| PubChem CID | 91555528 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (5R)-5-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | C1=NC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C9H9NO/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-5,7,9H,6H2/t9-/m0/s1 |
| InChIKey | YEMVKBHTRGTNJT-VIFPVBQESA-N |
| XLogP | 1.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-phenyl-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-phenyl-4,5-dihydro-1,3-oxazole?
The IUPAC name of (5R)-5-phenyl-4,5-dihydro-1,3-oxazole (CID 91555528) is (5R)-5-phenyl-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for (5R)-5-phenyl-4,5-dihydro-1,3-oxazole?
The canonical SMILES for (5R)-5-phenyl-4,5-dihydro-1,3-oxazole is C1=NC[C@@H](c2ccccc2)O1.
What is the InChIKey of (5R)-5-phenyl-4,5-dihydro-1,3-oxazole?
The InChIKey is YEMVKBHTRGTNJT-VIFPVBQESA-N. The full InChI is InChI=1S/C9H9NO/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-5,7,9H,6H2/t9-/m0/s1.
What are the key properties of (5R)-5-phenyl-4,5-dihydro-1,3-oxazole?
(5R)-5-phenyl-4,5-dihydro-1,3-oxazole has a molecular weight of 147.18 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-phenyl-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 91555528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).