C8H8N2O — CID 154572908
5-phenyl-4,5-dihydrooxadiazole (PubChem CID 154572908) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 5-phenyl-4,5-dihydrooxadiazole.
| Compound Name | 5-phenyl-4,5-dihydrooxadiazole |
|---|---|
| PubChem CID | 154572908 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 5-phenyl-4,5-dihydrooxadiazole |
| SMILES | c1ccc(C2CN=NO2)cc1 |
| InChI | InChI=1S/C8H8N2O/c1-2-4-7(5-3-1)8-6-9-10-11-8/h1-5,8H,6H2 |
| InChIKey | SAIZTIVTBKHONT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |