C12H15NO — CID 142422179
5-(4-propan-2-ylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 142422179) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 5-(4-propan-2-ylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 5-(4-propan-2-ylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 142422179 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 5-(4-propan-2-ylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)c1ccc(C2CN=CO2)cc1 |
| InChI | InChI=1S/C12H15NO/c1-9(2)10-3-5-11(6-4-10)12-7-13-8-14-12/h3-6,8-9,12H,7H2,1-2H3 |
| InChIKey | DJWVXXKGQKUJEW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |