C12H12N2O2 — CID 162468857
4-(4-propan-2-ylphenyl)pyrazole-3,5-dione (PubChem CID 162468857) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-(4-propan-2-ylphenyl)pyrazole-3,5-dione.
| Compound Name | 4-(4-propan-2-ylphenyl)pyrazole-3,5-dione |
|---|---|
| PubChem CID | 162468857 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-(4-propan-2-ylphenyl)pyrazole-3,5-dione |
| SMILES | CC(C)c1ccc(C2C(=O)N=NC2=O)cc1 |
| InChI | InChI=1S/C12H12N2O2/c1-7(2)8-3-5-9(6-4-8)10-11(15)13-14-12(10)16/h3-7,10H,1-2H3 |
| InChIKey | BTWFTSQIUKQJHQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|