C14H21N — CID 124744909
(1S)-1-[(1S,2R)-2-(4-propan-2-ylphenyl)cyclopropyl]ethanamine (PubChem CID 124744909) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (1S)-1-[(1S,2R)-2-(4-propan-2-ylphenyl)cyclopropyl]ethanamine.
| Compound Name | (1S)-1-[(1S,2R)-2-(4-propan-2-ylphenyl)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 124744909 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (1S)-1-[(1S,2R)-2-(4-propan-2-ylphenyl)cyclopropyl]ethanamine |
| SMILES | CC(C)c1ccc([C@@H]2C[C@@H]2[C@H](C)N)cc1 |
| InChI | InChI=1S/C14H21N/c1-9(2)11-4-6-12(7-5-11)14-8-13(14)10(3)15/h4-7,9-10,13-14H,8,15H2,1-3H3/t10-,13+,14-/m0/s1 |
| InChIKey | CARPVSQLWBUNLD-GDLCADMTSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |