C13H19NO2 — CID 28912479
(1R)-1-[(1S,2S)-2-(3,4-dimethoxyphenyl)cyclopropyl]ethanamine (PubChem CID 28912479) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (1R)-1-[(1S,2S)-2-(3,4-dimethoxyphenyl)cyclopropyl]ethanamine.
| Compound Name | (1R)-1-[(1S,2S)-2-(3,4-dimethoxyphenyl)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 28912479 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (1R)-1-[(1S,2S)-2-(3,4-dimethoxyphenyl)cyclopropyl]ethanamine |
| SMILES | COc1ccc([C@H]2C[C@@H]2[C@@H](C)N)cc1OC |
| InChI | InChI=1S/C13H19NO2/c1-8(14)10-7-11(10)9-4-5-12(15-2)13(6-9)16-3/h4-6,8,10-11H,7,14H2,1-3H3/t8-,10-,11-/m1/s1 |
| InChIKey | HYRHCZXUDHOWNL-FBIMIBRVSA-N |
| XLogP | 2.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |