C14H21NO3 — CID 124552560
(1S)-1-[(1R,2R)-2-(2,4,6-trimethoxyphenyl)cyclopropyl]ethanamine (PubChem CID 124552560) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (1S)-1-[(1R,2R)-2-(2,4,6-trimethoxyphenyl)cyclopropyl]ethanamine.
| Compound Name | (1S)-1-[(1R,2R)-2-(2,4,6-trimethoxyphenyl)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 124552560 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (1S)-1-[(1R,2R)-2-(2,4,6-trimethoxyphenyl)cyclopropyl]ethanamine |
| SMILES | COc1cc(OC)c([C@@H]2C[C@H]2[C@H](C)N)c(OC)c1 |
| InChI | InChI=1S/C14H21NO3/c1-8(15)10-7-11(10)14-12(17-3)5-9(16-2)6-13(14)18-4/h5-6,8,10-11H,7,15H2,1-4H3/t8-,10-,11+/m0/s1 |
| InChIKey | DWPAOPGTQTXRQL-INTQDDNPSA-N |
| XLogP | 2.16 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |