C11H13NO2 — CID 82158129
5,7-dimethoxy-1H-inden-1-amine (PubChem CID 82158129) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 5,7-dimethoxy-1H-inden-1-amine.
| Compound Name | 5,7-dimethoxy-1H-inden-1-amine |
|---|---|
| PubChem CID | 82158129 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 5,7-dimethoxy-1H-inden-1-amine |
| SMILES | COc1cc2c(c(OC)c1)C(N)C=C2 |
| InChI | InChI=1S/C11H13NO2/c1-13-8-5-7-3-4-9(12)11(7)10(6-8)14-2/h3-6,9H,12H2,1-2H3 |
| InChIKey | JXIRHVRIYCKXHU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |