C11H13NO — CID 45091183
6-methoxy-1,2-dihydronaphthalen-2-amine (PubChem CID 45091183) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 6-methoxy-1,2-dihydronaphthalen-2-amine.
| Compound Name | 6-methoxy-1,2-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 45091183 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 6-methoxy-1,2-dihydronaphthalen-2-amine |
| SMILES | COc1ccc2c(c1)C=CC(N)C2 |
| InChI | InChI=1S/C11H13NO/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h2-5,7,10H,6,12H2,1H3 |
| InChIKey | WUORSNYJGMLKTG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |