C12H14O2 — CID 13364263
3,6-dimethoxy-1,2-dihydronaphthalene (PubChem CID 13364263) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3,6-dimethoxy-1,2-dihydronaphthalene.
| Compound Name | 3,6-dimethoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 13364263 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3,6-dimethoxy-1,2-dihydronaphthalene |
| SMILES | COC1=Cc2cc(OC)ccc2CC1 |
| InChI | InChI=1S/C12H14O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | JPYZCFYVCPSPJW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |