7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid

C12H12O3 — CID 67598336

IUPAC7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid
SMILESCOc1ccc2c(c1)C=C(C(=O)O)CC2
InChIInChI=1S/C12H12O3/c1-15-11-5-4-8-2-3-9(12(13)14)6-10(8)7-11/h4-7H,2-3H2,1H3,(H,13,14)
InChIKeyDBSBRJGTHOQYOH-UHFFFAOYSA-N
MW204.22 g/mol
LogP2.11
Rot. Bonds2

About 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid

7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid (PubChem CID 67598336) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid.

Molecular Properties

Compound Name7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid
PubChem CID67598336
Molecular FormulaC12H12O3
Molecular Weight204.22 g/mol
Exact Mass204.08
IUPAC Name7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid
SMILESCOc1ccc2c(c1)C=C(C(=O)O)CC2
InChIInChI=1S/C12H12O3/c1-15-11-5-4-8-2-3-9(12(13)14)6-10(8)7-11/h4-7H,2-3H2,1H3,(H,13,14)
InChIKeyDBSBRJGTHOQYOH-UHFFFAOYSA-N
XLogP2.11
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.22
LogP ≤ 52.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid?
The IUPAC name of 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid (CID 67598336) is 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid.
What is the SMILES notation for 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid?
The canonical SMILES for 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid is COc1ccc2c(c1)C=C(C(=O)O)CC2.
What is the InChIKey of 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid?
The InChIKey is DBSBRJGTHOQYOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-15-11-5-4-8-2-3-9(12(13)14)6-10(8)7-11/h4-7H,2-3H2,1H3,(H,13,14).
What are the key properties of 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid?
7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid has a molecular weight of 204.22 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3,4-dihydronaphthalene-2-carboxylic acid is sourced from PubChem (CID 67598336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).