C19H22N2O5 — CID 70271646
but-2-enedioic acid;5-[(7-methoxy-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 70271646) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is but-2-enedioic acid;5-[(7-methoxy-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole.
| Compound Name | but-2-enedioic acid;5-[(7-methoxy-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 70271646 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | but-2-enedioic acid;5-[(7-methoxy-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc2c(c1)C=C(CC1CN=CN1)CC2.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H18N2O.C4H4O4/c1-18-15-5-4-12-3-2-11(6-13(12)8-15)7-14-9-16-10-17-14;5-3(6)1-2-4(7)8/h4-6,8,10,14H,2-3,7,9H2,1H3,(H,16,17);1-2H,(H,5,6)(H,7,8) |
| InChIKey | RJKDBHQYHBDRTK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|