C34H32O6 — CID 102287735
1,3,6,8-tetramethoxy-5,10-bis(4-methoxyphenyl)-5,10-dihydroindeno[2,1-a]indene (PubChem CID 102287735) has the molecular formula C34H32O6 and a molecular weight of 536.62 g/mol. Its IUPAC name is 1,3,6,8-tetramethoxy-5,10-bis(4-methoxyphenyl)-5,10-dihydroindeno[2,1-a]indene.
| Compound Name | 1,3,6,8-tetramethoxy-5,10-bis(4-methoxyphenyl)-5,10-dihydroindeno[2,1-a]indene |
|---|---|
| PubChem CID | 102287735 |
| Molecular Formula | C34H32O6 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 1,3,6,8-tetramethoxy-5,10-bis(4-methoxyphenyl)-5,10-dihydroindeno[2,1-a]indene |
| SMILES | COc1ccc(C2C3=C(c4cc(OC)cc(OC)c42)C(c2ccc(OC)cc2)c2c(OC)cc(OC)cc23)cc1 |
| InChI | InChI=1S/C34H32O6/c1-35-21-11-7-19(8-12-21)29-31-25(15-23(37-3)17-27(31)39-5)34-30(20-9-13-22(36-2)14-10-20)32-26(33(29)34)16-24(38-4)18-28(32)40-6/h7-18,29-30H,1-6H3 |
| InChIKey | GATAIPUTCTUYEB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|