C11H16ClNO3 — CID 171252301
(4R)-5,7-dimethoxy-3,4-dihydro-2H-chromen-4-amine;hydrochloride (PubChem CID 171252301) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is (4R)-5,7-dimethoxy-3,4-dihydro-2H-chromen-4-amine;hydrochloride.
| Compound Name | (4R)-5,7-dimethoxy-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
|---|---|
| PubChem CID | 171252301 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (4R)-5,7-dimethoxy-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| SMILES | COc1cc(OC)c2c(c1)OCC[C@H]2N.Cl |
| InChI | InChI=1S/C11H15NO3.ClH/c1-13-7-5-9(14-2)11-8(12)3-4-15-10(11)6-7;/h5-6,8H,3-4,12H2,1-2H3;1H/t8-;/m1./s1 |
| InChIKey | NCLYGLGSRVCLBS-DDWIOCJRSA-N |
| XLogP | 1.91 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |