C9H9ClF3NO — CID 171252159
(4S)-5,6,7-trifluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (PubChem CID 171252159) has the molecular formula C9H9ClF3NO and a molecular weight of 239.62 g/mol. Its IUPAC name is (4S)-5,6,7-trifluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride.
| Compound Name | (4S)-5,6,7-trifluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
|---|---|
| PubChem CID | 171252159 |
| Molecular Formula | C9H9ClF3NO |
| Molecular Weight | 239.62 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (4S)-5,6,7-trifluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| SMILES | Cl.N[C@H]1CCOc2cc(F)c(F)c(F)c21 |
| InChI | InChI=1S/C9H8F3NO.ClH/c10-4-3-6-7(9(12)8(4)11)5(13)1-2-14-6;/h3,5H,1-2,13H2;1H/t5-;/m0./s1 |
| InChIKey | SLCOOXKPRJKZAF-JEDNCBNOSA-N |
| XLogP | 2.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.62 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|