C11H9F6NO — CID 171252359
(4R)-5,7-bis(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 171252359) has the molecular formula C11H9F6NO and a molecular weight of 285.19 g/mol. Its IUPAC name is (4R)-5,7-bis(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-5,7-bis(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 171252359 |
| Molecular Formula | C11H9F6NO |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (4R)-5,7-bis(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1CCOc2cc(C(F)(F)F)cc(C(F)(F)F)c21 |
| InChI | InChI=1S/C11H9F6NO/c12-10(13,14)5-3-6(11(15,16)17)9-7(18)1-2-19-8(9)4-5/h3-4,7H,1-2,18H2/t7-/m1/s1 |
| InChIKey | NXKMLSGPCMJVKS-SSDOTTSWSA-N |
| XLogP | 3.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |