C10H8ClF3O — CID 89103867
4-chloro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene (PubChem CID 89103867) has the molecular formula C10H8ClF3O and a molecular weight of 236.62 g/mol. Its IUPAC name is 4-chloro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene.
| Compound Name | 4-chloro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 89103867 |
| Molecular Formula | C10H8ClF3O |
| Molecular Weight | 236.62 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 4-chloro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene |
| SMILES | FC(F)(F)c1ccc2c(c1)OCCC2Cl |
| InChI | InChI=1S/C10H8ClF3O/c11-8-3-4-15-9-5-6(10(12,13)14)1-2-7(8)9/h1-2,5,8H,3-4H2 |
| InChIKey | RVWOEXHZGCHHQJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|