C9H9FINO — CID 130779709
(4R)-6-fluoro-5-iodo-3,4-dihydro-2H-chromen-4-amine (PubChem CID 130779709) has the molecular formula C9H9FINO and a molecular weight of 293.08 g/mol. Its IUPAC name is (4R)-6-fluoro-5-iodo-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-6-fluoro-5-iodo-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 130779709 |
| Molecular Formula | C9H9FINO |
| Molecular Weight | 293.08 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | (4R)-6-fluoro-5-iodo-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1CCOc2ccc(F)c(I)c21 |
| InChI | InChI=1S/C9H9FINO/c10-5-1-2-7-8(9(5)11)6(12)3-4-13-7/h1-2,6H,3-4,12H2/t6-/m1/s1 |
| InChIKey | YUAORVRJZMHEGT-ZCFIWIBFSA-N |
| XLogP | 2.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.08 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|