C9H11FN2O — CID 131161469
(4R)-7-fluoro-3,4-dihydro-2H-chromene-4,8-diamine (PubChem CID 131161469) has the molecular formula C9H11FN2O and a molecular weight of 182.20 g/mol. Its IUPAC name is (4R)-7-fluoro-3,4-dihydro-2H-chromene-4,8-diamine.
| Compound Name | (4R)-7-fluoro-3,4-dihydro-2H-chromene-4,8-diamine |
|---|---|
| PubChem CID | 131161469 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (4R)-7-fluoro-3,4-dihydro-2H-chromene-4,8-diamine |
| SMILES | Nc1c(F)ccc2c1OCC[C@H]2N |
| InChI | InChI=1S/C9H11FN2O/c10-6-2-1-5-7(11)3-4-13-9(5)8(6)12/h1-2,7H,3-4,11-12H2/t7-/m1/s1 |
| InChIKey | YHOJRFLAHAJGNO-SSDOTTSWSA-N |
| XLogP | 1.19 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|