About (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine
(4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 130613783) has the molecular formula C10H13NOS
and a molecular weight of 195.29 g/mol. Its IUPAC name is (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine.
Molecular Properties
| Compound Name | (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine |
| PubChem CID | 130613783 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CSc1cccc2c1OCC[C@@H]2N |
| InChI | InChI=1S/C10H13NOS/c1-13-9-4-2-3-7-8(11)5-6-12-10(7)9/h2-4,8H,5-6,11H2,1H3/t8-/m0/s1 |
| InChIKey | QXUMPQXFEMZMBY-QMMMGPOBSA-N |
| XLogP | 2.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine?
The IUPAC name of (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine (CID 130613783) is (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine.
What is the SMILES notation for (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine?
The canonical SMILES for (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine is CSc1cccc2c1OCC[C@@H]2N.
What is the InChIKey of (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine?
The InChIKey is QXUMPQXFEMZMBY-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H13NOS/c1-13-9-4-2-3-7-8(11)5-6-12-10(7)9/h2-4,8H,5-6,11H2,1H3/t8-/m0/s1.
What are the key properties of (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine?
(4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine has a molecular weight of 195.29 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine is sourced from PubChem (CID 130613783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).