C10H13NOS — CID 130613783
(4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 130613783) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 130613783 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (4S)-8-methylsulfanyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CSc1cccc2c1OCC[C@@H]2N |
| InChI | InChI=1S/C10H13NOS/c1-13-9-4-2-3-7-8(11)5-6-12-10(7)9/h2-4,8H,5-6,11H2,1H3/t8-/m0/s1 |
| InChIKey | QXUMPQXFEMZMBY-QMMMGPOBSA-N |
| XLogP | 2.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |