C10H13NO2S — CID 130707462
(4R)-4-amino-7-methylsulfanyl-3,4-dihydro-2H-chromen-8-ol (PubChem CID 130707462) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is (4R)-4-amino-7-methylsulfanyl-3,4-dihydro-2H-chromen-8-ol.
| Compound Name | (4R)-4-amino-7-methylsulfanyl-3,4-dihydro-2H-chromen-8-ol |
|---|---|
| PubChem CID | 130707462 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (4R)-4-amino-7-methylsulfanyl-3,4-dihydro-2H-chromen-8-ol |
| SMILES | CSc1ccc2c(c1O)OCC[C@H]2N |
| InChI | InChI=1S/C10H13NO2S/c1-14-8-3-2-6-7(11)4-5-13-10(6)9(8)12/h2-3,7,12H,4-5,11H2,1H3/t7-/m1/s1 |
| InChIKey | FVBWPQKZIVGSAI-SSDOTTSWSA-N |
| XLogP | 1.90 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |