C9H8ClF2NO — CID 131151157
(4R)-8-chloro-5,6-difluoro-3,4-dihydro-2H-chromen-4-amine (PubChem CID 131151157) has the molecular formula C9H8ClF2NO and a molecular weight of 219.62 g/mol. Its IUPAC name is (4R)-8-chloro-5,6-difluoro-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-8-chloro-5,6-difluoro-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 131151157 |
| Molecular Formula | C9H8ClF2NO |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | (4R)-8-chloro-5,6-difluoro-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1CCOc2c(Cl)cc(F)c(F)c21 |
| InChI | InChI=1S/C9H8ClF2NO/c10-4-3-5(11)8(12)7-6(13)1-2-14-9(4)7/h3,6H,1-2,13H2/t6-/m1/s1 |
| InChIKey | MWHAOQUMATUILZ-ZCFIWIBFSA-N |
| XLogP | 2.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|