C10H10BrF2NO — CID 107100721
(5R)-6-bromo-8,9-difluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 107100721) has the molecular formula C10H10BrF2NO and a molecular weight of 278.10 g/mol. Its IUPAC name is (5R)-6-bromo-8,9-difluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | (5R)-6-bromo-8,9-difluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 107100721 |
| Molecular Formula | C10H10BrF2NO |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | (5R)-6-bromo-8,9-difluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | N[C@@H]1CCCOc2c(F)c(F)cc(Br)c21 |
| InChI | InChI=1S/C10H10BrF2NO/c11-5-4-6(12)9(13)10-8(5)7(14)2-1-3-15-10/h4,7H,1-3,14H2/t7-/m1/s1 |
| InChIKey | GLXVWPYCHICVIH-SSDOTTSWSA-N |
| XLogP | 2.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|