C9H7BrF2O — CID 141158645
8-bromo-5,6-difluoro-3,4-dihydro-2H-chromene (PubChem CID 141158645) has the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. Its IUPAC name is 8-bromo-5,6-difluoro-3,4-dihydro-2H-chromene.
| Compound Name | 8-bromo-5,6-difluoro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 141158645 |
| Molecular Formula | C9H7BrF2O |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 8-bromo-5,6-difluoro-3,4-dihydro-2H-chromene |
| SMILES | Fc1cc(Br)c2c(c1F)CCCO2 |
| InChI | InChI=1S/C9H7BrF2O/c10-6-4-7(11)8(12)5-2-1-3-13-9(5)6/h4H,1-3H2 |
| InChIKey | ZFZYRJUPOPLMOW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|