C9H8BrFO — CID 155778553
8-bromo-7-fluoro-3,4-dihydro-2H-chromene (PubChem CID 155778553) has the molecular formula C9H8BrFO and a molecular weight of 231.06 g/mol. Its IUPAC name is 8-bromo-7-fluoro-3,4-dihydro-2H-chromene.
| Compound Name | 8-bromo-7-fluoro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 155778553 |
| Molecular Formula | C9H8BrFO |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 8-bromo-7-fluoro-3,4-dihydro-2H-chromene |
| SMILES | Fc1ccc2c(c1Br)OCCC2 |
| InChI | InChI=1S/C9H8BrFO/c10-8-7(11)4-3-6-2-1-5-12-9(6)8/h3-4H,1-2,5H2 |
| InChIKey | OVXUPXRFNMTDPN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |