C12H13FO2 — CID 117297394
3-(7-fluoro-3,4-dihydro-2H-chromen-8-yl)propanal (PubChem CID 117297394) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 3-(7-fluoro-3,4-dihydro-2H-chromen-8-yl)propanal.
| Compound Name | 3-(7-fluoro-3,4-dihydro-2H-chromen-8-yl)propanal |
|---|---|
| PubChem CID | 117297394 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 3-(7-fluoro-3,4-dihydro-2H-chromen-8-yl)propanal |
| SMILES | O=CCCc1c(F)ccc2c1OCCC2 |
| InChI | InChI=1S/C12H13FO2/c13-11-6-5-9-3-2-8-15-12(9)10(11)4-1-7-14/h5-7H,1-4,8H2 |
| InChIKey | BIKMELUZRNAMMT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|