About 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile
2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile (PubChem CID 117277411) has the molecular formula C10H8FNO
and a molecular weight of 177.18 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile.
Analyze 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile?
The IUPAC name of 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile (CID 117277411) is 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile.
What is the SMILES notation for 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile?
The canonical SMILES for 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile is N#CCc1c(F)ccc2c1OCC2.
What is the InChIKey of 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile?
The InChIKey is BTDVKESEDAYHDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO/c11-9-2-1-7-4-6-13-10(7)8(9)3-5-12/h1-2H,3-4,6H2.
What are the key properties of 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile?
2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile has a molecular weight of 177.18 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)acetonitrile is sourced from PubChem (CID 117277411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).