C9H8BrFO — CID 171829628
6-(bromomethyl)-7-fluoro-2,3-dihydro-1-benzofuran (PubChem CID 171829628) has the molecular formula C9H8BrFO and a molecular weight of 231.06 g/mol. Its IUPAC name is 6-(bromomethyl)-7-fluoro-2,3-dihydro-1-benzofuran.
| Compound Name | 6-(bromomethyl)-7-fluoro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 171829628 |
| Molecular Formula | C9H8BrFO |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 6-(bromomethyl)-7-fluoro-2,3-dihydro-1-benzofuran |
| SMILES | Fc1c(CBr)ccc2c1OCC2 |
| InChI | InChI=1S/C9H8BrFO/c10-5-7-2-1-6-3-4-12-9(6)8(7)11/h1-2H,3-5H2 |
| InChIKey | JUJZNJHYLTXRQL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|