About (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine
(E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine (PubChem CID 117283537) has the molecular formula C11H12FNO
and a molecular weight of 193.22 g/mol. Its IUPAC name is (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine |
| PubChem CID | 117283537 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine |
| SMILES | NC/C=C/c1c(F)ccc2c1OCC2 |
| InChI | InChI=1S/C11H12FNO/c12-10-4-3-8-5-7-14-11(8)9(10)2-1-6-13/h1-4H,5-7,13H2/b2-1+ |
| InChIKey | YYHBNBCYXHOTCT-OWOJBTEDSA-N |
| XLogP | 1.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine?
The IUPAC name of (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine (CID 117283537) is (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine.
What is the SMILES notation for (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine?
The canonical SMILES for (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine is NC/C=C/c1c(F)ccc2c1OCC2.
What is the InChIKey of (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine?
The InChIKey is YYHBNBCYXHOTCT-OWOJBTEDSA-N. The full InChI is InChI=1S/C11H12FNO/c12-10-4-3-8-5-7-14-11(8)9(10)2-1-6-13/h1-4H,5-7,13H2/b2-1+.
What are the key properties of (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine?
(E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine has a molecular weight of 193.22 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(6-fluoro-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-amine is sourced from PubChem (CID 117283537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).