C11H14FNO — CID 130845713
(1R)-1-(7-fluoro-3,4-dihydro-2H-chromen-8-yl)ethanamine (PubChem CID 130845713) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is (1R)-1-(7-fluoro-3,4-dihydro-2H-chromen-8-yl)ethanamine.
| Compound Name | (1R)-1-(7-fluoro-3,4-dihydro-2H-chromen-8-yl)ethanamine |
|---|---|
| PubChem CID | 130845713 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (1R)-1-(7-fluoro-3,4-dihydro-2H-chromen-8-yl)ethanamine |
| SMILES | C[C@@H](N)c1c(F)ccc2c1OCCC2 |
| InChI | InChI=1S/C11H14FNO/c1-7(13)10-9(12)5-4-8-3-2-6-14-11(8)10/h4-5,7H,2-3,6,13H2,1H3/t7-/m1/s1 |
| InChIKey | LSPJQOWSQBZJQQ-SSDOTTSWSA-N |
| XLogP | 2.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |